C10H14N4O — CID 58529282
4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)butan-1-ol (PubChem CID 58529282) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)butan-1-ol.
| Compound Name | 4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)butan-1-ol |
|---|---|
| PubChem CID | 58529282 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)butan-1-ol |
| SMILES | Nc1ncnn2c(CCCCO)ccc12 |
| InChI | InChI=1S/C10H14N4O/c11-10-9-5-4-8(3-1-2-6-15)14(9)13-7-12-10/h4-5,7,15H,1-3,6H2,(H2,11,12,13) |
| InChIKey | NHJIMEOUWHFTOC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|