C11H14N4O5 — CID 121313180
(2R,3R,4R)-1-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,3,4,5-tetrahydroxypentan-1-one (PubChem CID 121313180) has the molecular formula C11H14N4O5 and a molecular weight of 282.26 g/mol. Its IUPAC name is (2R,3R,4R)-1-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,3,4,5-tetrahydroxypentan-1-one.
| Compound Name | (2R,3R,4R)-1-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,3,4,5-tetrahydroxypentan-1-one |
|---|---|
| PubChem CID | 121313180 |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (2R,3R,4R)-1-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,3,4,5-tetrahydroxypentan-1-one |
| SMILES | Nc1ncnn2c(C(=O)[C@H](O)[C@H](O)[C@H](O)CO)ccc12 |
| InChI | InChI=1S/C11H14N4O5/c12-11-6-2-1-5(15(6)14-4-13-11)8(18)10(20)9(19)7(17)3-16/h1-2,4,7,9-10,16-17,19-20H,3H2,(H2,12,13,14)/t7-,9-,10+/m1/s1 |
| InChIKey | BMUDDCFCFBKLIN-QNSHHTMESA-N |
| XLogP | -2.43 |
| TPSA | 154.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |