C10H13NO5 — CID 23579935
(2R,3R,4R)-2,3,4,5-tetrahydroxy-1-pyridin-2-ylpentan-1-one (PubChem CID 23579935) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is (2R,3R,4R)-2,3,4,5-tetrahydroxy-1-pyridin-2-ylpentan-1-one.
| Compound Name | (2R,3R,4R)-2,3,4,5-tetrahydroxy-1-pyridin-2-ylpentan-1-one |
|---|---|
| PubChem CID | 23579935 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | (2R,3R,4R)-2,3,4,5-tetrahydroxy-1-pyridin-2-ylpentan-1-one |
| SMILES | O=C(c1ccccn1)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H13NO5/c12-5-7(13)9(15)10(16)8(14)6-3-1-2-4-11-6/h1-4,7,9-10,12-13,15-16H,5H2/t7-,9-,10+/m1/s1 |
| InChIKey | OQSRVMXNPVQTKP-QNSHHTMESA-N |
| XLogP | -1.66 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |