C32H32N4O5 — CID 167227998
(2R,4R)-1-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-hydroxy-2,4,5-tris(phenylmethoxy)pentan-1-one (PubChem CID 167227998) has the molecular formula C32H32N4O5 and a molecular weight of 552.63 g/mol. Its IUPAC name is (2R,4R)-1-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-hydroxy-2,4,5-tris(phenylmethoxy)pentan-1-one.
| Compound Name | (2R,4R)-1-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-hydroxy-2,4,5-tris(phenylmethoxy)pentan-1-one |
|---|---|
| PubChem CID | 167227998 |
| Molecular Formula | C32H32N4O5 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | (2R,4R)-1-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-hydroxy-2,4,5-tris(phenylmethoxy)pentan-1-one |
| SMILES | Nc1ncnn2c(C(=O)[C@@H](C[C@](O)(COCc3ccccc3)OCc3ccccc3)OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C32H32N4O5/c33-31-28-17-16-27(36(28)35-23-34-31)30(37)29(40-20-25-12-6-2-7-13-25)18-32(38,41-21-26-14-8-3-9-15-26)22-39-19-24-10-4-1-5-11-24/h1-17,23,29,38H,18-22H2,(H2,33,34,35)/t29-,32-/m1/s1 |
| InChIKey | OEHLWQOWTQEDGY-QLWXXVCSSA-N |
| XLogP | 4.59 |
| TPSA | 121.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|