C32H34N4O4 — CID 166743707
(2R,3R,4S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-1,3,4-tris(phenylmethoxy)pentan-2-ol (PubChem CID 166743707) has the molecular formula C32H34N4O4 and a molecular weight of 538.65 g/mol. Its IUPAC name is (2R,3R,4S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-1,3,4-tris(phenylmethoxy)pentan-2-ol.
| Compound Name | (2R,3R,4S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-1,3,4-tris(phenylmethoxy)pentan-2-ol |
|---|---|
| PubChem CID | 166743707 |
| Molecular Formula | C32H34N4O4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | (2R,3R,4S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-1,3,4-tris(phenylmethoxy)pentan-2-ol |
| SMILES | Nc1ncnn2c(C[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H](O)COCc3ccccc3)ccc12 |
| InChI | InChI=1S/C32H34N4O4/c33-32-28-17-16-27(36(28)35-23-34-32)18-30(39-20-25-12-6-2-7-13-25)31(40-21-26-14-8-3-9-15-26)29(37)22-38-19-24-10-4-1-5-11-24/h1-17,23,29-31,37H,18-22H2,(H2,33,34,35)/t29-,30+,31-/m1/s1 |
| InChIKey | IXHAYJBEYXBMDG-MJSOWUPRSA-N |
| XLogP | 4.60 |
| TPSA | 104.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |