C34H35N5O4 — CID 134443516
(3S,4S,5R)-5-[(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)methoxy]-3,4,6-tris(phenylmethoxy)hexanenitrile (PubChem CID 134443516) has the molecular formula C34H35N5O4 and a molecular weight of 577.69 g/mol. Its IUPAC name is (3S,4S,5R)-5-[(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)methoxy]-3,4,6-tris(phenylmethoxy)hexanenitrile.
| Compound Name | (3S,4S,5R)-5-[(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)methoxy]-3,4,6-tris(phenylmethoxy)hexanenitrile |
|---|---|
| PubChem CID | 134443516 |
| Molecular Formula | C34H35N5O4 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | (3S,4S,5R)-5-[(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)methoxy]-3,4,6-tris(phenylmethoxy)hexanenitrile |
| SMILES | N#CC[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OCc1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C34H35N5O4/c35-19-18-31(41-21-27-12-6-2-7-13-27)33(43-22-28-14-8-3-9-15-28)32(24-40-20-26-10-4-1-5-11-26)42-23-29-16-17-30-34(36)37-25-38-39(29)30/h1-17,25,31-33H,18,20-24H2,(H2,36,37,38)/t31-,32+,33-/m0/s1 |
| InChIKey | BMPZFWQRIJNACR-DSPMFFIESA-N |
| XLogP | 5.50 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |