C36H38N2O4 — CID 11103712
5-methyl-3-[(1R,2S,3R)-1,2,3,4-tetrakis(phenylmethoxy)butyl]-1H-pyrazole (PubChem CID 11103712) has the molecular formula C36H38N2O4 and a molecular weight of 562.71 g/mol. Its IUPAC name is 5-methyl-3-[(1R,2S,3R)-1,2,3,4-tetrakis(phenylmethoxy)butyl]-1H-pyrazole.
| Compound Name | 5-methyl-3-[(1R,2S,3R)-1,2,3,4-tetrakis(phenylmethoxy)butyl]-1H-pyrazole |
|---|---|
| PubChem CID | 11103712 |
| Molecular Formula | C36H38N2O4 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | 5-methyl-3-[(1R,2S,3R)-1,2,3,4-tetrakis(phenylmethoxy)butyl]-1H-pyrazole |
| SMILES | Cc1cc([C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)OCc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C36H38N2O4/c1-28-22-33(38-37-28)35(41-25-31-18-10-4-11-19-31)36(42-26-32-20-12-5-13-21-32)34(40-24-30-16-8-3-9-17-30)27-39-23-29-14-6-2-7-15-29/h2-22,34-36H,23-27H2,1H3,(H,37,38)/t34-,35-,36-/m1/s1 |
| InChIKey | QZFMWRJHPWNBPM-KUFDTJSHSA-N |
| XLogP | 7.36 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |