C54H52N2O9 — CID 135079954
dimethyl 4-[(1S,2S,3R,4R)-1,2,3,4,5-pentakis(phenylmethoxy)pentyl]-5-phenylpyridazine-3,6-dicarboxylate (PubChem CID 135079954) has the molecular formula C54H52N2O9 and a molecular weight of 873.02 g/mol. Its IUPAC name is dimethyl 4-[(1S,2S,3R,4R)-1,2,3,4,5-pentakis(phenylmethoxy)pentyl]-5-phenylpyridazine-3,6-dicarboxylate.
| Compound Name | dimethyl 4-[(1S,2S,3R,4R)-1,2,3,4,5-pentakis(phenylmethoxy)pentyl]-5-phenylpyridazine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 135079954 |
| Molecular Formula | C54H52N2O9 |
| Molecular Weight | 873.02 g/mol |
| Exact Mass | 872.37 |
| IUPAC Name | dimethyl 4-[(1S,2S,3R,4R)-1,2,3,4,5-pentakis(phenylmethoxy)pentyl]-5-phenylpyridazine-3,6-dicarboxylate |
| SMILES | COC(=O)c1nnc(C(=O)OC)c([C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)OCc2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C54H52N2O9/c1-59-53(57)48-46(44-31-19-8-20-32-44)47(49(56-55-48)54(58)60-2)51(64-36-42-27-15-6-16-28-42)52(65-37-43-29-17-7-18-30-43)50(63-35-41-25-13-5-14-26-41)45(62-34-40-23-11-4-12-24-40)38-61-33-39-21-9-3-10-22-39/h3-32,45,50-52H,33-38H2,1-2H3/t45-,50-,51+,52-/m1/s1 |
| InChIKey | ZPPUYIWVTGFCIZ-YYJRMOKBSA-N |
| XLogP | 9.95 |
| TPSA | 124.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.02 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |