C35H38N4O5 — CID 174087095
(2S,3R,4R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-methyl-1,3,4-tris(phenylmethoxy)hept-6-ene-2,5-diol (PubChem CID 174087095) has the molecular formula C35H38N4O5 and a molecular weight of 594.71 g/mol. Its IUPAC name is (2S,3R,4R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-methyl-1,3,4-tris(phenylmethoxy)hept-6-ene-2,5-diol.
| Compound Name | (2S,3R,4R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-methyl-1,3,4-tris(phenylmethoxy)hept-6-ene-2,5-diol |
|---|---|
| PubChem CID | 174087095 |
| Molecular Formula | C35H38N4O5 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | (2S,3R,4R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6-methyl-1,3,4-tris(phenylmethoxy)hept-6-ene-2,5-diol |
| SMILES | C=C(C)C(O)(c1ccc2c(N)ncnn12)[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C35H38N4O5/c1-25(2)35(41,31-19-18-29-34(36)37-24-38-39(29)31)33(44-22-28-16-10-5-11-17-28)32(43-21-27-14-8-4-9-15-27)30(40)23-42-20-26-12-6-3-7-13-26/h3-19,24,30,32-33,40-41H,1,20-23H2,2H3,(H2,36,37,38)/t30-,32+,33+,35?/m0/s1 |
| InChIKey | HCFKOKVNAROGRX-ZFJCWVJQSA-N |
| XLogP | 4.82 |
| TPSA | 124.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|