C25H41N4O7PS2 — CID 138739729
S-[2-[[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxybutoxy]-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 138739729) has the molecular formula C25H41N4O7PS2 and a molecular weight of 604.73 g/mol. Its IUPAC name is S-[2-[[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxybutoxy]-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxybutoxy]-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 138739729 |
| Molecular Formula | C25H41N4O7PS2 |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | S-[2-[[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxybutoxy]-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | COC(CCc1ccc2c(N)ncnn12)COP(=O)(OCCSC(=O)C(C)(C)C)OCCSC(=O)C(C)(C)C |
| InChI | InChI=1S/C25H41N4O7PS2/c1-24(2,3)22(30)38-14-12-34-37(32,35-13-15-39-23(31)25(4,5)6)36-16-19(33-7)10-8-18-9-11-20-21(26)27-17-28-29(18)20/h9,11,17,19H,8,10,12-16H2,1-7H3,(H2,26,27,28) |
| InChIKey | NQKLYPMMPUPRIJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 144.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|