C25H38N5O7PS2 — CID 123341411
S-[2-[[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-ethenyl-3-hydroxy-2-[(methylideneamino)methyl]oxolan-2-yl]methoxy-(2-methylsulfanylethoxy)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 123341411) has the molecular formula C25H38N5O7PS2 and a molecular weight of 615.72 g/mol. Its IUPAC name is S-[2-[[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-ethenyl-3-hydroxy-2-[(methylideneamino)methyl]oxolan-2-yl]methoxy-(2-methylsulfanylethoxy)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-ethenyl-3-hydroxy-2-[(methylideneamino)methyl]oxolan-2-yl]methoxy-(2-methylsulfanylethoxy)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 123341411 |
| Molecular Formula | C25H38N5O7PS2 |
| Molecular Weight | 615.72 g/mol |
| Exact Mass | 615.20 |
| IUPAC Name | S-[2-[[5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-ethenyl-3-hydroxy-2-[(methylideneamino)methyl]oxolan-2-yl]methoxy-(2-methylsulfanylethoxy)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | C=CC1C(c2ccc3c(N)ncnn23)OC(CN=C)(COP(=O)(OCCSC)OCCSC(=O)C(C)(C)C)C1O |
| InChI | InChI=1S/C25H38N5O7PS2/c1-7-17-20(18-8-9-19-22(26)28-16-29-30(18)19)37-25(14-27-5,21(17)31)15-36-38(33,34-10-12-39-6)35-11-13-40-23(32)24(2,3)4/h7-9,16-17,20-21,31H,1,5,10-15H2,2-4,6H3,(H2,26,28,29) |
| InChIKey | AVEFFUZIZNMGHJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 159.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.72 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|