C25H38FN4O8PS2 — CID 123718178
S-[2-[[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 123718178) has the molecular formula C25H38FN4O8PS2 and a molecular weight of 636.71 g/mol. Its IUPAC name is S-[2-[[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 123718178 |
| Molecular Formula | C25H38FN4O8PS2 |
| Molecular Weight | 636.71 g/mol |
| Exact Mass | 636.19 |
| IUPAC Name | S-[2-[[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=O)SCCOP(=O)(OCCSC(=O)C(C)(C)C)OCC1OCC(F)(c2ccc3c(N)ncnn23)C1O |
| InChI | InChI=1S/C25H38FN4O8PS2/c1-23(2,3)21(32)40-11-9-36-39(34,37-10-12-41-22(33)24(4,5)6)38-13-17-19(31)25(26,14-35-17)18-8-7-16-20(27)28-15-29-30(16)18/h7-8,15,17,19,31H,9-14H2,1-6H3,(H2,27,28,29) |
| InChIKey | ZRWUIEZPOQENBX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 164.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.71 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|