C26H40N3O9PS3 — CID 46872255
S-[2-[[(2R,3R,4R)-5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 46872255) has the molecular formula C26H40N3O9PS3 and a molecular weight of 665.79 g/mol. Its IUPAC name is S-[2-[[(2R,3R,4R)-5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,3R,4R)-5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 46872255 |
| Molecular Formula | C26H40N3O9PS3 |
| Molecular Weight | 665.79 g/mol |
| Exact Mass | 665.17 |
| IUPAC Name | S-[2-[[(2R,3R,4R)-5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=O)SCCOP(=O)(OCCSC(=O)C(C)(C)C)OC[C@H]1OC(c2scc3c(N)ncnc23)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C26H40N3O9PS3/c1-24(2,3)22(31)40-10-8-35-39(34,36-9-11-41-23(32)25(4,5)6)37-12-16-19(30)26(7,33)20(38-16)18-17-15(13-42-18)21(27)29-14-28-17/h13-14,16,19-20,30,33H,8-12H2,1-7H3,(H2,27,28,29)/t16-,19-,20?,26-/m1/s1 |
| InChIKey | XFNBCBZEIRHODP-YXYOPZHYSA-N |
| XLogP | 4.59 |
| TPSA | 180.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.79 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|