C26H43N6O9PS — CID 16727864
S-[2-[[(2R,3R,4R,5R)-5-[6-[amino(methyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4,4-dimethyl-3-oxopentoxy)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 16727864) has the molecular formula C26H43N6O9PS and a molecular weight of 646.70 g/mol. Its IUPAC name is S-[2-[[(2R,3R,4R,5R)-5-[6-[amino(methyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4,4-dimethyl-3-oxopentoxy)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,3R,4R,5R)-5-[6-[amino(methyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4,4-dimethyl-3-oxopentoxy)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 16727864 |
| Molecular Formula | C26H43N6O9PS |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.25 |
| IUPAC Name | S-[2-[[(2R,3R,4R,5R)-5-[6-[amino(methyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4,4-dimethyl-3-oxopentoxy)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CN(N)c1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(OCCSC(=O)C(C)(C)C)OCCC(=O)C(C)(C)C)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C26H43N6O9PS/c1-24(2,3)17(33)9-10-38-42(37,39-11-12-43-23(35)25(4,5)6)40-13-16-19(34)26(7,36)22(41-16)32-15-30-18-20(31(8)27)28-14-29-21(18)32/h14-16,19,22,34,36H,9-13,27H2,1-8H3/t16-,19-,22-,26-,42?/m1/s1 |
| InChIKey | BNBMOWDXAAENNW-PVPPLJBDSA-N |
| XLogP | 2.61 |
| TPSA | 201.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|