C21H34ClN6O8PS — CID 173476378
S-[2-[[(2R)-5-(2-amino-6-chloropurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(propan-2-ylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 173476378) has the molecular formula C21H34ClN6O8PS and a molecular weight of 597.03 g/mol. Its IUPAC name is S-[2-[[(2R)-5-(2-amino-6-chloropurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(propan-2-ylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R)-5-(2-amino-6-chloropurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(propan-2-ylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 173476378 |
| Molecular Formula | C21H34ClN6O8PS |
| Molecular Weight | 597.03 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | S-[2-[[(2R)-5-(2-amino-6-chloropurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(propan-2-ylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC(C)NP(=O)(OCCSC(=O)C(C)(C)CO)OC[C@H]1OC(n2cnc3c(Cl)nc(N)nc32)C(C)(O)C1O |
| InChI | InChI=1S/C21H34ClN6O8PS/c1-11(2)27-37(33,34-6-7-38-18(31)20(3,4)9-29)35-8-12-14(30)21(5,32)17(36-12)28-10-24-13-15(22)25-19(23)26-16(13)28/h10-12,14,17,29-30,32H,6-9H2,1-5H3,(H,27,33)(H2,23,25,26)/t12-,14?,17?,21?,37?/m1/s1 |
| InChIKey | VFPZNWQECIMMFK-USTHOJEHSA-N |
| XLogP | 1.49 |
| TPSA | 204.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.03 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|