C26H40N3O10PS2 — CID 11679069
S-[2-[[5-(4-aminofuro[3,2-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 11679069) has the molecular formula C26H40N3O10PS2 and a molecular weight of 649.73 g/mol. Its IUPAC name is S-[2-[[5-(4-aminofuro[3,2-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[5-(4-aminofuro[3,2-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 11679069 |
| Molecular Formula | C26H40N3O10PS2 |
| Molecular Weight | 649.73 g/mol |
| Exact Mass | 649.19 |
| IUPAC Name | S-[2-[[5-(4-aminofuro[3,2-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=O)SCCOP(=O)(OCCSC(=O)C(C)(C)C)OCC1OC(c2coc3c(N)ncnc23)C(C)(O)C1O |
| InChI | InChI=1S/C26H40N3O10PS2/c1-24(2,3)22(31)41-10-8-36-40(34,37-9-11-42-23(32)25(4,5)6)38-13-16-19(30)26(7,33)20(39-16)15-12-35-18-17(15)28-14-29-21(18)27/h12,14,16,19-20,30,33H,8-11,13H2,1-7H3,(H2,27,28,29) |
| InChIKey | DVFXKHOVBKQOSP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 193.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.73 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|