C26H42N3O10PS2 — CID 173003296
O-[2-[[5-(4-aminofuro[3,2-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-ethylphosphoryl]-2-[1-(dihydroxy-λ4-sulfanylidene)-2,2-dimethylpropoxy]ethyl] 2,2-dimethylpropanethioate (PubChem CID 173003296) has the molecular formula C26H42N3O10PS2 and a molecular weight of 651.74 g/mol. Its IUPAC name is O-[2-[[5-(4-aminofuro[3,2-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-ethylphosphoryl]-2-[1-(dihydroxy-λ4-sulfanylidene)-2,2-dimethylpropoxy]ethyl] 2,2-dimethylpropanethioate.
| Compound Name | O-[2-[[5-(4-aminofuro[3,2-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-ethylphosphoryl]-2-[1-(dihydroxy-λ4-sulfanylidene)-2,2-dimethylpropoxy]ethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 173003296 |
| Molecular Formula | C26H42N3O10PS2 |
| Molecular Weight | 651.74 g/mol |
| Exact Mass | 651.20 |
| IUPAC Name | O-[2-[[5-(4-aminofuro[3,2-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-ethylphosphoryl]-2-[1-(dihydroxy-λ4-sulfanylidene)-2,2-dimethylpropoxy]ethyl] 2,2-dimethylpropanethioate |
| SMILES | CCP(=O)(OCC1OC(c2coc3c(N)ncnc23)C(C)(O)C1O)C(COC(=S)C(C)(C)C)OC(=S(O)O)C(C)(C)C |
| InChI | InChI=1S/C26H42N3O10PS2/c1-9-40(32,16(12-36-22(41)24(2,3)4)39-23(42(33)34)25(5,6)7)37-11-15-19(30)26(8,31)20(38-15)14-10-35-18-17(14)28-13-29-21(18)27/h10,13,15-16,19-20,30-31,33-34H,9,11-12H2,1-8H3,(H2,27,28,29) |
| InChIKey | QUCFTACPGVZZAS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 199.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.74 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|