C23H22ClN3O6 — CID 25118986
[(3aS,4S,6R,6aR)-4-(4-aminofuro[3,2-d]pyrimidin-7-yl)-2-(4-chlorophenyl)-3a-methyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl cyclopropanecarboxylate (PubChem CID 25118986) has the molecular formula C23H22ClN3O6 and a molecular weight of 471.90 g/mol. Its IUPAC name is [(3aS,4S,6R,6aR)-4-(4-aminofuro[3,2-d]pyrimidin-7-yl)-2-(4-chlorophenyl)-3a-methyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl cyclopropanecarboxylate.
| Compound Name | [(3aS,4S,6R,6aR)-4-(4-aminofuro[3,2-d]pyrimidin-7-yl)-2-(4-chlorophenyl)-3a-methyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl cyclopropanecarboxylate |
|---|---|
| PubChem CID | 25118986 |
| Molecular Formula | C23H22ClN3O6 |
| Molecular Weight | 471.90 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | [(3aS,4S,6R,6aR)-4-(4-aminofuro[3,2-d]pyrimidin-7-yl)-2-(4-chlorophenyl)-3a-methyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl cyclopropanecarboxylate |
| SMILES | C[C@@]12OC(c3ccc(Cl)cc3)O[C@@H]1[C@@H](COC(=O)C1CC1)O[C@H]2c1coc2c(N)ncnc12 |
| InChI | InChI=1S/C23H22ClN3O6/c1-23-18(14-8-29-17-16(14)26-10-27-20(17)25)31-15(9-30-21(28)11-2-3-11)19(23)32-22(33-23)12-4-6-13(24)7-5-12/h4-8,10-11,15,18-19,22H,2-3,9H2,1H3,(H2,25,26,27)/t15-,18+,19-,22?,23+/m1/s1 |
| InChIKey | SNVMCNQPLOGWKN-SSZLBPNRSA-N |
| XLogP | 3.72 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.90 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |