C17H17N3O6S — CID 135875934
7-[(3aS,4S,6R,6aR)-6-(hydroxymethyl)-3a-methyl-2-thiophen-2-yl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]-2-amino-3H-furo[3,2-d]pyrimidin-4-one (PubChem CID 135875934) has the molecular formula C17H17N3O6S and a molecular weight of 391.41 g/mol. Its IUPAC name is 7-[(3aS,4S,6R,6aR)-6-(hydroxymethyl)-3a-methyl-2-thiophen-2-yl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]-2-amino-3H-furo[3,2-d]pyrimidin-4-one.
| Compound Name | 7-[(3aS,4S,6R,6aR)-6-(hydroxymethyl)-3a-methyl-2-thiophen-2-yl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]-2-amino-3H-furo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135875934 |
| Molecular Formula | C17H17N3O6S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 7-[(3aS,4S,6R,6aR)-6-(hydroxymethyl)-3a-methyl-2-thiophen-2-yl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]-2-amino-3H-furo[3,2-d]pyrimidin-4-one |
| SMILES | C[C@@]12OC(c3cccs3)O[C@@H]1[C@@H](CO)O[C@H]2c1coc2c(=O)[nH]c(N)nc12 |
| InChI | InChI=1S/C17H17N3O6S/c1-17-12(7-6-23-11-10(7)19-16(18)20-14(11)22)24-8(5-21)13(17)25-15(26-17)9-3-2-4-27-9/h2-4,6,8,12-13,15,21H,5H2,1H3,(H3,18,19,20,22)/t8-,12+,13-,15?,17+/m1/s1 |
| InChIKey | NPXHMGWHEMXYLR-FCYUABQSSA-N |
| XLogP | 1.46 |
| TPSA | 132.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |