C14H15N5O4S — CID 136648350
2-amino-9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-thiophen-2-yl-1H-purin-6-one (PubChem CID 136648350) has the molecular formula C14H15N5O4S and a molecular weight of 349.37 g/mol. Its IUPAC name is 2-amino-9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-thiophen-2-yl-1H-purin-6-one.
| Compound Name | 2-amino-9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-thiophen-2-yl-1H-purin-6-one |
|---|---|
| PubChem CID | 136648350 |
| Molecular Formula | C14H15N5O4S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-amino-9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-thiophen-2-yl-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(-c3cccs3)n2C2CC(O)C(CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H15N5O4S/c15-14-17-12-10(13(22)18-14)16-11(8-2-1-3-24-8)19(12)9-4-6(21)7(5-20)23-9/h1-3,6-7,9,20-21H,4-5H2,(H3,15,17,18,22) |
| InChIKey | XEUPVQOWUJOWJT-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |