C20H28N12O8 — CID 161116161
2,8-diamino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 161116161) has the molecular formula C20H28N12O8 and a molecular weight of 564.52 g/mol. Its IUPAC name is 2,8-diamino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2,8-diamino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 161116161 |
| Molecular Formula | C20H28N12O8 |
| Molecular Weight | 564.52 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 2,8-diamino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(N)n2[C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]1.Nc1nc2c(nc(N)n2[C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/2C10H14N6O4/c2*11-9-14-7-6(8(19)15-9)13-10(12)16(7)5-1-3(18)4(2-17)20-5/h2*3-5,17-18H,1-2H2,(H2,12,13)(H3,11,14,15,19)/t2*3-,4+,5+/m00/s1 |
| InChIKey | UKINQYKNCWTSCW-IBVPOFDWSA-N |
| XLogP | -4.15 |
| TPSA | 330.60 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.52 |
| LogP ≤ 5 | -4.15 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 18 |