C34H37N3O5 — CID 143157560
7-[(2R,5S)-3-methyl-5-(trityloxymethyl)oxolan-2-yl]furo[3,2-d]pyrimidin-4-amine;propane-2,2-diol (PubChem CID 143157560) has the molecular formula C34H37N3O5 and a molecular weight of 567.69 g/mol. Its IUPAC name is 7-[(2R,5S)-3-methyl-5-(trityloxymethyl)oxolan-2-yl]furo[3,2-d]pyrimidin-4-amine;propane-2,2-diol.
| Compound Name | 7-[(2R,5S)-3-methyl-5-(trityloxymethyl)oxolan-2-yl]furo[3,2-d]pyrimidin-4-amine;propane-2,2-diol |
|---|---|
| PubChem CID | 143157560 |
| Molecular Formula | C34H37N3O5 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 7-[(2R,5S)-3-methyl-5-(trityloxymethyl)oxolan-2-yl]furo[3,2-d]pyrimidin-4-amine;propane-2,2-diol |
| SMILES | CC(C)(O)O.CC1C[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H]1c1coc2c(N)ncnc12 |
| InChI | InChI=1S/C31H29N3O3.C3H8O2/c1-21-17-25(37-28(21)26-19-35-29-27(26)33-20-34-30(29)32)18-36-31(22-11-5-2-6-12-22,23-13-7-3-8-14-23)24-15-9-4-10-16-24;1-3(2,4)5/h2-16,19-21,25,28H,17-18H2,1H3,(H2,32,33,34);4-5H,1-2H3/t21?,25-,28+;/m0./s1 |
| InChIKey | KXYFMOVONNNQBH-DCOIUJJHSA-N |
| XLogP | 5.99 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|