C31H39NO4 — CID 143157543
acetonitrile;(5S)-2,3-dimethyl-5-(trityloxymethyl)oxolane;propane-2,2-diol (PubChem CID 143157543) has the molecular formula C31H39NO4 and a molecular weight of 489.66 g/mol. Its IUPAC name is acetonitrile;(5S)-2,3-dimethyl-5-(trityloxymethyl)oxolane;propane-2,2-diol.
| Compound Name | acetonitrile;(5S)-2,3-dimethyl-5-(trityloxymethyl)oxolane;propane-2,2-diol |
|---|---|
| PubChem CID | 143157543 |
| Molecular Formula | C31H39NO4 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | acetonitrile;(5S)-2,3-dimethyl-5-(trityloxymethyl)oxolane;propane-2,2-diol |
| SMILES | CC#N.CC(C)(O)O.CC1C[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)OC1C |
| InChI | InChI=1S/C26H28O2.C3H8O2.C2H3N/c1-20-18-25(28-21(20)2)19-27-26(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24;1-3(2,4)5;1-2-3/h3-17,20-21,25H,18-19H2,1-2H3;4-5H,1-2H3;1H3/t20?,21?,25-;;/m0../s1 |
| InChIKey | HCMUZPVUWLIXPC-HWSODIJSSA-N |
| XLogP | 6.05 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|