C33H38O3 — CID 10838517
(E)-3-methyl-1-[(2R,3R,5R)-3-prop-1-en-2-yl-5-(trityloxymethyl)oxolan-2-yl]pent-3-en-2-ol (PubChem CID 10838517) has the molecular formula C33H38O3 and a molecular weight of 482.66 g/mol. Its IUPAC name is (E)-3-methyl-1-[(2R,3R,5R)-3-prop-1-en-2-yl-5-(trityloxymethyl)oxolan-2-yl]pent-3-en-2-ol.
| Compound Name | (E)-3-methyl-1-[(2R,3R,5R)-3-prop-1-en-2-yl-5-(trityloxymethyl)oxolan-2-yl]pent-3-en-2-ol |
|---|---|
| PubChem CID | 10838517 |
| Molecular Formula | C33H38O3 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | (E)-3-methyl-1-[(2R,3R,5R)-3-prop-1-en-2-yl-5-(trityloxymethyl)oxolan-2-yl]pent-3-en-2-ol |
| SMILES | C=C(C)[C@H]1C[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@@H]1CC(O)/C(C)=C/C |
| InChI | InChI=1S/C33H38O3/c1-5-25(4)31(34)22-32-30(24(2)3)21-29(36-32)23-35-33(26-15-9-6-10-16-26,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h5-20,29-32,34H,2,21-23H2,1,3-4H3/b25-5+/t29-,30-,31?,32-/m1/s1 |
| InChIKey | YSLJZJOWUSUKHL-ZWGKTASNSA-N |
| XLogP | 7.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|