C30H35NO4 — CID 143157544
acetonitrile;2-[(5S)-3-methyl-5-(trityloxymethyl)oxolan-3-yl]oxypropan-2-ol (PubChem CID 143157544) has the molecular formula C30H35NO4 and a molecular weight of 473.61 g/mol. Its IUPAC name is acetonitrile;2-[(5S)-3-methyl-5-(trityloxymethyl)oxolan-3-yl]oxypropan-2-ol.
| Compound Name | acetonitrile;2-[(5S)-3-methyl-5-(trityloxymethyl)oxolan-3-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 143157544 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | acetonitrile;2-[(5S)-3-methyl-5-(trityloxymethyl)oxolan-3-yl]oxypropan-2-ol |
| SMILES | CC#N.CC(C)(O)OC1(C)CO[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C28H32O4.C2H3N/c1-26(2,29)32-27(3)19-25(30-21-27)20-31-28(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24;1-2-3/h4-18,25,29H,19-21H2,1-3H3;1H3/t25-,27?;/m0./s1 |
| InChIKey | YMIHPARULPZGEU-DENGTNMUSA-N |
| XLogP | 5.82 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|