C18H26ClN4O7PS — CID 58519486
S-[2-[[(2R,3R,4R,5R)-5-(7-chloroimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(dimethylamino)phosphoryl]oxyethyl] ethanethioate (PubChem CID 58519486) has the molecular formula C18H26ClN4O7PS and a molecular weight of 508.92 g/mol. Its IUPAC name is S-[2-[[(2R,3R,4R,5R)-5-(7-chloroimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(dimethylamino)phosphoryl]oxyethyl] ethanethioate.
| Compound Name | S-[2-[[(2R,3R,4R,5R)-5-(7-chloroimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(dimethylamino)phosphoryl]oxyethyl] ethanethioate |
|---|---|
| PubChem CID | 58519486 |
| Molecular Formula | C18H26ClN4O7PS |
| Molecular Weight | 508.92 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | S-[2-[[(2R,3R,4R,5R)-5-(7-chloroimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(dimethylamino)phosphoryl]oxyethyl] ethanethioate |
| SMILES | CC(=O)SCCOP(=O)(OC[C@H]1O[C@@H](n2cnc3c(Cl)ccnc32)[C@](C)(O)[C@@H]1O)N(C)C |
| InChI | InChI=1S/C18H26ClN4O7PS/c1-11(24)32-8-7-28-31(27,22(3)4)29-9-13-15(25)18(2,26)17(30-13)23-10-21-14-12(19)5-6-20-16(14)23/h5-6,10,13,15,17,25-26H,7-9H2,1-4H3/t13-,15-,17-,18-,31?/m1/s1 |
| InChIKey | RSZWJFKBGXAGOO-ULVRJRNSSA-N |
| XLogP | 2.08 |
| TPSA | 136.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.92 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|