C17H29N4O7PS — CID 90397417
S-[2-[[(2R,3S,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(dimethylamino)phosphoryl]oxyethyl] ethanethioate (PubChem CID 90397417) has the molecular formula C17H29N4O7PS and a molecular weight of 464.48 g/mol. Its IUPAC name is S-[2-[[(2R,3S,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(dimethylamino)phosphoryl]oxyethyl] ethanethioate.
| Compound Name | S-[2-[[(2R,3S,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(dimethylamino)phosphoryl]oxyethyl] ethanethioate |
|---|---|
| PubChem CID | 90397417 |
| Molecular Formula | C17H29N4O7PS |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | S-[2-[[(2R,3S,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(dimethylamino)phosphoryl]oxyethyl] ethanethioate |
| SMILES | C=C1N=C(N)C=CN1[C@@H]1O[C@H](COP(=O)(OCCSC(C)=O)N(C)C)[C@H](O)C1(C)O |
| InChI | InChI=1S/C17H29N4O7PS/c1-11-19-14(18)6-7-21(11)16-17(3,24)15(23)13(28-16)10-27-29(25,20(4)5)26-8-9-30-12(2)22/h6-7,13,15-16,23-24H,1,8-10H2,2-5H3,(H2,18,19)/t13-,15+,16-,17?,29?/m1/s1 |
| InChIKey | OTKVCVGZIHJCIB-UCXVPIJSSA-N |
| XLogP | 0.46 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|