C28H37N4O8P — CID 59483406
butyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 59483406) has the molecular formula C28H37N4O8P and a molecular weight of 588.60 g/mol. Its IUPAC name is butyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 59483406 |
| Molecular Formula | C28H37N4O8P |
| Molecular Weight | 588.60 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | butyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | C=C1N=C(N)C=CN1[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(=O)OCCCC)Oc2cccc3ccccc23)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C28H37N4O8P/c1-5-6-16-37-26(34)18(2)31-41(36,40-22-13-9-11-20-10-7-8-12-21(20)22)38-17-23-25(33)28(4,35)27(39-23)32-15-14-24(29)30-19(32)3/h7-15,18,23,25,27,33,35H,3,5-6,16-17H2,1-2,4H3,(H2,29,30)(H,31,36)/t18-,23+,25+,27+,28+,41?/m0/s1 |
| InChIKey | KEWIOVKWVACZNM-FREYIXMJSA-N |
| XLogP | 3.16 |
| TPSA | 165.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|