C25H31N4O7PS — CID 90273600
methyl 2-[[[(2R,3R,4R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate (PubChem CID 90273600) has the molecular formula C25H31N4O7PS and a molecular weight of 562.59 g/mol. Its IUPAC name is methyl 2-[[[(2R,3R,4R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate.
| Compound Name | methyl 2-[[[(2R,3R,4R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 90273600 |
| Molecular Formula | C25H31N4O7PS |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | methyl 2-[[[(2R,3R,4R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphinothioyl]amino]propanoate |
| SMILES | C=C1N=C(N)C=CN1[C@@H]1O[C@H](COP(=S)(NC(C)C(=O)OC)Oc2cccc3ccccc23)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C25H31N4O7PS/c1-15(23(31)33-4)28-37(38,36-19-11-7-9-17-8-5-6-10-18(17)19)34-14-20-22(30)25(3,32)24(35-20)29-13-12-21(26)27-16(29)2/h5-13,15,20,22,24,30,32H,2,14H2,1,3-4H3,(H2,26,27)(H,28,38)/t15?,20-,22-,24-,25-,37?/m1/s1 |
| InChIKey | RBYIMZBIDIIWAG-JIEREFFNSA-N |
| XLogP | 2.11 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|