C22H31N4O9P — CID 160822266
ethyl (2S)-2-[[[(2R,4R,5R)-3,4-dihydroxy-5-[4-(hydroxyamino)-2-methylidenepyrimidin-1-yl]-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 160822266) has the molecular formula C22H31N4O9P and a molecular weight of 526.48 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,4R,5R)-3,4-dihydroxy-5-[4-(hydroxyamino)-2-methylidenepyrimidin-1-yl]-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,4R,5R)-3,4-dihydroxy-5-[4-(hydroxyamino)-2-methylidenepyrimidin-1-yl]-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 160822266 |
| Molecular Formula | C22H31N4O9P |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,4R,5R)-3,4-dihydroxy-5-[4-(hydroxyamino)-2-methylidenepyrimidin-1-yl]-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C1N=C(NO)C=CN1[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(=O)OCC)Oc2ccccc2)C(O)[C@@]1(C)O |
| InChI | InChI=1S/C22H31N4O9P/c1-5-32-20(28)14(2)25-36(31,35-16-9-7-6-8-10-16)33-13-17-19(27)22(4,29)21(34-17)26-12-11-18(24-30)23-15(26)3/h6-12,14,17,19,21,27,29-30H,3,5,13H2,1-2,4H3,(H,23,24)(H,25,31)/t14-,17+,19?,21+,22+,36?/m0/s1 |
| InChIKey | UNYGQMRBLJFXNK-BXIXZFFUSA-N |
| XLogP | 1.25 |
| TPSA | 171.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|