C25H36FN4O10P — CID 163707536
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[4-(ethoxycarbonylamino)-2-hydroxy-2H-pyrimidin-1-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 163707536) has the molecular formula C25H36FN4O10P and a molecular weight of 602.55 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[4-(ethoxycarbonylamino)-2-hydroxy-2H-pyrimidin-1-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[4-(ethoxycarbonylamino)-2-hydroxy-2H-pyrimidin-1-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163707536 |
| Molecular Formula | C25H36FN4O10P |
| Molecular Weight | 602.55 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[4-(ethoxycarbonylamino)-2-hydroxy-2H-pyrimidin-1-yl]-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)NC1=NC(O)N([C@@H]2O[C@H](CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc3ccccc3)[C@@H](O)[C@@]2(C)F)C=C1 |
| InChI | InChI=1S/C25H36FN4O10P/c1-6-36-24(34)28-19-12-13-30(23(33)27-19)22-25(5,26)20(31)18(39-22)14-37-41(35,40-17-10-8-7-9-11-17)29-16(4)21(32)38-15(2)3/h7-13,15-16,18,20,22-23,31,33H,6,14H2,1-5H3,(H,29,35)(H,27,28,34)/t16-,18+,20+,22+,23?,25+,41-/m0/s1 |
| InChIKey | KGJFADFTZMLBNF-SPWWESLFSA-N |
| XLogP | 2.18 |
| TPSA | 177.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.55 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|