C27H30F2N5O9P — CID 158010257
1-(4-nitrophenyl)ethyl (2S)-2-[[[(2R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 158010257) has the molecular formula C27H30F2N5O9P and a molecular weight of 637.53 g/mol. Its IUPAC name is 1-(4-nitrophenyl)ethyl (2S)-2-[[[(2R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 1-(4-nitrophenyl)ethyl (2S)-2-[[[(2R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 158010257 |
| Molecular Formula | C27H30F2N5O9P |
| Molecular Weight | 637.53 g/mol |
| Exact Mass | 637.17 |
| IUPAC Name | 1-(4-nitrophenyl)ethyl (2S)-2-[[[(2R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C1N=C(N)C=CN1[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(=O)OC(C)c2ccc([N+](=O)[O-])cc2)Oc2ccccc2)C(O)C1(F)F |
| InChI | InChI=1S/C27H30F2N5O9P/c1-16(25(36)41-17(2)19-9-11-20(12-10-19)34(37)38)32-44(39,43-21-7-5-4-6-8-21)40-15-22-24(35)27(28,29)26(42-22)33-14-13-23(30)31-18(33)3/h4-14,16-17,22,24,26,35H,3,15H2,1-2H3,(H2,30,31)(H,32,39)/t16-,17?,22+,24?,26+,44?/m0/s1 |
| InChIKey | NSORNJJWSSXCHD-CYGAOSOTSA-N |
| XLogP | 3.76 |
| TPSA | 188.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|