C24H28N5O9PS — CID 163840417
(5-nitrofuran-2-yl)methyl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-3-hydroxythiolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 163840417) has the molecular formula C24H28N5O9PS and a molecular weight of 593.56 g/mol. Its IUPAC name is (5-nitrofuran-2-yl)methyl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-3-hydroxythiolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | (5-nitrofuran-2-yl)methyl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-3-hydroxythiolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163840417 |
| Molecular Formula | C24H28N5O9PS |
| Molecular Weight | 593.56 g/mol |
| Exact Mass | 593.13 |
| IUPAC Name | (5-nitrofuran-2-yl)methyl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-methylidenepyrimidin-1-yl)-3-hydroxythiolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C1N=C(N)C=CN1[C@H]1C[C@@H](O)[C@@H](COP(=O)(N[C@@H](C)C(=O)OCc2ccc([N+](=O)[O-])o2)Oc2ccccc2)S1 |
| InChI | InChI=1S/C24H28N5O9PS/c1-15(24(31)35-13-18-8-9-22(37-18)29(32)33)27-39(34,38-17-6-4-3-5-7-17)36-14-20-19(30)12-23(40-20)28-11-10-21(25)26-16(28)2/h3-11,15,19-20,23,30H,2,12-14H2,1H3,(H2,25,26)(H,27,34)/t15-,19+,20+,23+,39?/m0/s1 |
| InChIKey | XVIMTPULZOPLHZ-NERCMXEXSA-N |
| XLogP | 3.26 |
| TPSA | 191.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|