C22H25N6O10PS — CID 162485182
(5-nitrofuran-2-yl)methyl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3-hydroxythiolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 162485182) has the molecular formula C22H25N6O10PS and a molecular weight of 596.52 g/mol. Its IUPAC name is (5-nitrofuran-2-yl)methyl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3-hydroxythiolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | (5-nitrofuran-2-yl)methyl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3-hydroxythiolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 162485182 |
| Molecular Formula | C22H25N6O10PS |
| Molecular Weight | 596.52 g/mol |
| Exact Mass | 596.11 |
| IUPAC Name | (5-nitrofuran-2-yl)methyl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3-hydroxythiolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](N[P@](=O)(OC[C@H]1S[C@@H](n2cnc(N)nc2=O)C[C@H]1O)Oc1ccccc1)C(=O)OCc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C22H25N6O10PS/c1-13(20(30)35-10-15-7-8-18(37-15)28(32)33)26-39(34,38-14-5-3-2-4-6-14)36-11-17-16(29)9-19(40-17)27-12-24-21(23)25-22(27)31/h2-8,12-13,16-17,19,29H,9-11H2,1H3,(H,26,34)(H2,23,25,31)/t13-,16+,17+,19+,39-/m0/s1 |
| InChIKey | GWIWNSGFZXTXHX-JACSVKQASA-N |
| XLogP | 2.01 |
| TPSA | 224.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|