C26H29N8O8PS — CID 158064063
(3-methyl-2-nitroimidazol-4-yl)methyl (2S)-2-[[[(2S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)thiolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 158064063) has the molecular formula C26H29N8O8PS and a molecular weight of 644.61 g/mol. Its IUPAC name is (3-methyl-2-nitroimidazol-4-yl)methyl (2S)-2-[[[(2S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)thiolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | (3-methyl-2-nitroimidazol-4-yl)methyl (2S)-2-[[[(2S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)thiolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 158064063 |
| Molecular Formula | C26H29N8O8PS |
| Molecular Weight | 644.61 g/mol |
| Exact Mass | 644.16 |
| IUPAC Name | (3-methyl-2-nitroimidazol-4-yl)methyl (2S)-2-[[[(2S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)thiolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@@H]1CC[C@H](n2cnc(N)nc2=O)S1)Oc1cccc2ccccc12)C(=O)OCc1cnc([N+](=O)[O-])n1C |
| InChI | InChI=1S/C26H29N8O8PS/c1-16(23(35)40-13-18-12-28-25(32(18)2)34(37)38)31-43(39,42-21-9-5-7-17-6-3-4-8-20(17)21)41-14-19-10-11-22(44-19)33-15-29-24(27)30-26(33)36/h3-9,12,15-16,19,22H,10-11,13-14H2,1-2H3,(H,31,39)(H2,27,30,36)/t16-,19-,22+,43?/m0/s1 |
| InChIKey | FKZXQVRMUPIHQO-CJKAQCKFSA-N |
| XLogP | 3.33 |
| TPSA | 208.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.61 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|