C22H26N5O7PS — CID 153353956
methyl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3-hydroxythiolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 153353956) has the molecular formula C22H26N5O7PS and a molecular weight of 535.52 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3-hydroxythiolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3-hydroxythiolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 153353956 |
| Molecular Formula | C22H26N5O7PS |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | methyl (2S)-2-[[[(2R,3R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3-hydroxythiolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@H]1S[C@@H](n2cnc(N)nc2=O)C[C@H]1O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C22H26N5O7PS/c1-13(20(29)32-2)26-35(31,34-17-9-5-7-14-6-3-4-8-15(14)17)33-11-18-16(28)10-19(36-18)27-12-24-21(23)25-22(27)30/h3-9,12-13,16,18-19,28H,10-11H2,1-2H3,(H,26,31)(H2,23,25,30)/t13-,16+,18+,19+,35?/m0/s1 |
| InChIKey | HQBHNFMTFLSARQ-WNGICPDTSA-N |
| XLogP | 2.09 |
| TPSA | 167.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|