C26H28FN6O7P — CID 129294091
benzyl (2S)-2-[[[(2S,5R)-5-(6-amino-2-fluoropurin-9-yl)-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 129294091) has the molecular formula C26H28FN6O7P and a molecular weight of 586.52 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2S,5R)-5-(6-amino-2-fluoropurin-9-yl)-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2S,5R)-5-(6-amino-2-fluoropurin-9-yl)-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 129294091 |
| Molecular Formula | C26H28FN6O7P |
| Molecular Weight | 586.52 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | benzyl (2S)-2-[[[(2S,5R)-5-(6-amino-2-fluoropurin-9-yl)-4-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@@H]1CC(O)[C@H](n2cnc3c(N)nc(F)nc32)O1)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H28FN6O7P/c1-16(25(35)37-13-17-8-4-2-5-9-17)32-41(36,40-18-10-6-3-7-11-18)38-14-19-12-20(34)24(39-19)33-15-29-21-22(28)30-26(27)31-23(21)33/h2-11,15-16,19-20,24,34H,12-14H2,1H3,(H,32,36)(H2,28,30,31)/t16-,19-,20?,24+,41?/m0/s1 |
| InChIKey | LNNZRTYROKLSBK-YIOXVYDZSA-N |
| XLogP | 3.12 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|