C18H26FN4O7PS — CID 58519544
S-[2-[dimethylamino-[[(2R,4S,5R)-4-fluoro-3-hydroxy-3-methyl-5-(7-oxo-6H-imidazo[4,5-b]pyridin-3-yl)oxolan-2-yl]methoxy]phosphoryl]oxyethyl] ethanethioate (PubChem CID 58519544) has the molecular formula C18H26FN4O7PS and a molecular weight of 492.47 g/mol. Its IUPAC name is S-[2-[dimethylamino-[[(2R,4S,5R)-4-fluoro-3-hydroxy-3-methyl-5-(7-oxo-6H-imidazo[4,5-b]pyridin-3-yl)oxolan-2-yl]methoxy]phosphoryl]oxyethyl] ethanethioate.
| Compound Name | S-[2-[dimethylamino-[[(2R,4S,5R)-4-fluoro-3-hydroxy-3-methyl-5-(7-oxo-6H-imidazo[4,5-b]pyridin-3-yl)oxolan-2-yl]methoxy]phosphoryl]oxyethyl] ethanethioate |
|---|---|
| PubChem CID | 58519544 |
| Molecular Formula | C18H26FN4O7PS |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | S-[2-[dimethylamino-[[(2R,4S,5R)-4-fluoro-3-hydroxy-3-methyl-5-(7-oxo-6H-imidazo[4,5-b]pyridin-3-yl)oxolan-2-yl]methoxy]phosphoryl]oxyethyl] ethanethioate |
| SMILES | CC(=O)SCCOP(=O)(OC[C@H]1O[C@@H](n2cnc3c2N=CCC3=O)[C@@H](F)C1(C)O)N(C)C |
| InChI | InChI=1S/C18H26FN4O7PS/c1-11(24)32-8-7-28-31(27,22(3)4)29-9-13-18(2,26)15(19)17(30-13)23-10-21-14-12(25)5-6-20-16(14)23/h6,10,13,15,17,26H,5,7-9H2,1-4H3/t13-,15-,17-,18?,31?/m1/s1 |
| InChIKey | GAEQMTZZPMVTCZ-SQWXAMAUSA-N |
| XLogP | 2.14 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|