C18H31O9PS2 — CID 174144623
[(2R,4S,5S)-2-[bis(2-acetylsulfanylethoxy)phosphoryloxy]-4,5,6-trimethyloxan-3-yl] acetate (PubChem CID 174144623) has the molecular formula C18H31O9PS2 and a molecular weight of 486.55 g/mol. Its IUPAC name is [(2R,4S,5S)-2-[bis(2-acetylsulfanylethoxy)phosphoryloxy]-4,5,6-trimethyloxan-3-yl] acetate.
| Compound Name | [(2R,4S,5S)-2-[bis(2-acetylsulfanylethoxy)phosphoryloxy]-4,5,6-trimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 174144623 |
| Molecular Formula | C18H31O9PS2 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | [(2R,4S,5S)-2-[bis(2-acetylsulfanylethoxy)phosphoryloxy]-4,5,6-trimethyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1[C@@H](OP(=O)(OCCSC(C)=O)OCCSC(C)=O)OC(C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C18H31O9PS2/c1-11-12(2)17(26-14(4)19)18(25-13(11)3)27-28(22,23-7-9-29-15(5)20)24-8-10-30-16(6)21/h11-13,17-18H,7-10H2,1-6H3/t11-,12-,13?,17?,18+/m0/s1 |
| InChIKey | GFZDBFAHBSHSDI-FESJIWPCSA-N |
| XLogP | 3.65 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|