C16H24N5O7P — CID 164959865
[2-(azidomethyl)-6-[bis(2-cyanoethoxy)phosphoryloxy]-4,5-dimethyloxan-3-yl] acetate (PubChem CID 164959865) has the molecular formula C16H24N5O7P and a molecular weight of 429.37 g/mol. Its IUPAC name is [2-(azidomethyl)-6-[bis(2-cyanoethoxy)phosphoryloxy]-4,5-dimethyloxan-3-yl] acetate.
| Compound Name | [2-(azidomethyl)-6-[bis(2-cyanoethoxy)phosphoryloxy]-4,5-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 164959865 |
| Molecular Formula | C16H24N5O7P |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [2-(azidomethyl)-6-[bis(2-cyanoethoxy)phosphoryloxy]-4,5-dimethyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(CN=[N+]=[N-])OC(OP(=O)(OCCC#N)OCCC#N)C(C)C1C |
| InChI | InChI=1S/C16H24N5O7P/c1-11-12(2)16(27-14(10-20-21-19)15(11)26-13(3)22)28-29(23,24-8-4-6-17)25-9-5-7-18/h11-12,14-16H,4-5,8-10H2,1-3H3 |
| InChIKey | FPFUZMGTGBFSEZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 176.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|