C26H49N4O9PS — CID 159645798
S-[2-[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(dibutylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate;methane (PubChem CID 159645798) has the molecular formula C26H49N4O9PS and a molecular weight of 624.74 g/mol. Its IUPAC name is S-[2-[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(dibutylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate;methane.
| Compound Name | S-[2-[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(dibutylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate;methane |
|---|---|
| PubChem CID | 159645798 |
| Molecular Formula | C26H49N4O9PS |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.30 |
| IUPAC Name | S-[2-[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(dibutylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate;methane |
| SMILES | C.CCCCN(CCCC)P(=O)(OCCSC(=O)C(C)(C)CO)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C25H45N4O9PS.CH4/c1-6-8-11-28(12-9-7-2)39(35,36-14-15-40-22(32)24(3,4)17-30)37-16-18-20(31)25(5,34)21(38-18)29-13-10-19(26)27-23(29)33;/h10,13,18,20-21,30-31,34H,6-9,11-12,14-17H2,1-5H3,(H2,26,27,33);1H4/t18-,20-,21-,25-,39?;/m1./s1 |
| InChIKey | MQYBIIJEJOWZPR-LOLBKTCJSA-N |
| XLogP | 2.79 |
| TPSA | 186.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|