C17H27ClN3O8PS — CID 140638012
S-[2-[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-3-hydroxy-4-methyloxolan-2-yl]methoxyphosphonoyloxy]ethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 140638012) has the molecular formula C17H27ClN3O8PS and a molecular weight of 499.91 g/mol. Its IUPAC name is S-[2-[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-3-hydroxy-4-methyloxolan-2-yl]methoxyphosphonoyloxy]ethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-3-hydroxy-4-methyloxolan-2-yl]methoxyphosphonoyloxy]ethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 140638012 |
| Molecular Formula | C17H27ClN3O8PS |
| Molecular Weight | 499.91 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | S-[2-[[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-3-hydroxy-4-methyloxolan-2-yl]methoxyphosphonoyloxy]ethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC(C)(CO)C(=O)SCCO[P@@H](=O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@](C)(Cl)[C@@H]1O |
| InChI | InChI=1S/C17H27ClN3O8PS/c1-16(2,9-22)14(24)31-7-6-27-30(26)28-8-10-12(23)17(3,18)13(29-10)21-5-4-11(19)20-15(21)25/h4-5,10,12-13,22-23,30H,6-9H2,1-3H3,(H2,19,20,25)/t10-,12-,13-,17-/m1/s1 |
| InChIKey | SYBIUVAKPICSNR-CNEMSGBDSA-N |
| XLogP | 0.78 |
| TPSA | 163.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.91 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|