C25H40N2O10PS2+ — CID 126554865
S-[2-[[(2R,4S,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 126554865) has the molecular formula C25H40N2O10PS2+ and a molecular weight of 623.71 g/mol. Its IUPAC name is S-[2-[[(2R,4S,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,4S,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 126554865 |
| Molecular Formula | C25H40N2O10PS2+ |
| Molecular Weight | 623.71 g/mol |
| Exact Mass | 623.19 |
| IUPAC Name | S-[2-[[(2R,4S,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=O)SCCOP(=O)(OCCSC(=O)C(C)(C)C)OC[C@H]1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@@H](O)C1O |
| InChI | InChI=1S/C25H39N2O10PS2/c1-24(2,3)22(31)39-12-10-34-38(33,35-11-13-40-23(32)25(4,5)6)36-15-17-18(28)19(29)21(37-17)27-9-7-8-16(14-27)20(26)30/h7-9,14,17-19,21,28-29H,10-13,15H2,1-6H3,(H-,26,30)/p+1/t17-,18?,19+,21-/m1/s1 |
| InChIKey | AYWGPYOEBNUZPX-LQDSCVQESA-O |
| XLogP | 2.46 |
| TPSA | 175.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.71 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|