C12H18N2O6PS2+ — CID 162489674
1-[(3R,4S,5R)-3,4-dihydroxy-5-[[methoxy(sulfanyl)phosphinothioyl]oxymethyl]oxolan-2-yl]pyridin-1-ium-3-carboxamide (PubChem CID 162489674) has the molecular formula C12H18N2O6PS2+ and a molecular weight of 381.39 g/mol. Its IUPAC name is 1-[(3R,4S,5R)-3,4-dihydroxy-5-[[methoxy(sulfanyl)phosphinothioyl]oxymethyl]oxolan-2-yl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-[(3R,4S,5R)-3,4-dihydroxy-5-[[methoxy(sulfanyl)phosphinothioyl]oxymethyl]oxolan-2-yl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 162489674 |
| Molecular Formula | C12H18N2O6PS2+ |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 1-[(3R,4S,5R)-3,4-dihydroxy-5-[[methoxy(sulfanyl)phosphinothioyl]oxymethyl]oxolan-2-yl]pyridin-1-ium-3-carboxamide |
| SMILES | COP(=S)(S)OC[C@H]1OC([n+]2cccc(C(N)=O)c2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H17N2O6PS2/c1-18-21(22,23)19-6-8-9(15)10(16)12(20-8)14-4-2-3-7(5-14)11(13)17/h2-5,8-10,12,15-16H,6H2,1H3,(H2-,13,17,22,23)/p+1/t8-,9-,10-,12?/m1/s1 |
| InChIKey | SYZUZNVTWUPWHN-HAFPMESGSA-O |
| XLogP | -0.49 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|