C11H14FN2O6PS — CID 167994931
1-[3-fluoro-4-hydroxy-5-[[hydroxy(oxido)phosphinothioyl]oxymethyl]oxolan-2-yl]pyridin-1-ium-3-carboxamide (PubChem CID 167994931) has the molecular formula C11H14FN2O6PS and a molecular weight of 352.28 g/mol. Its IUPAC name is 1-[3-fluoro-4-hydroxy-5-[[hydroxy(oxido)phosphinothioyl]oxymethyl]oxolan-2-yl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-[3-fluoro-4-hydroxy-5-[[hydroxy(oxido)phosphinothioyl]oxymethyl]oxolan-2-yl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 167994931 |
| Molecular Formula | C11H14FN2O6PS |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 1-[3-fluoro-4-hydroxy-5-[[hydroxy(oxido)phosphinothioyl]oxymethyl]oxolan-2-yl]pyridin-1-ium-3-carboxamide |
| SMILES | NC(=O)c1ccc[n+](C2OC(COP([O-])(O)=S)C(O)C2F)c1 |
| InChI | InChI=1S/C11H14FN2O6PS/c12-8-9(15)7(5-19-21(17,18)22)20-11(8)14-3-1-2-6(4-14)10(13)16/h1-4,7-9,11,15H,5H2,(H3-,13,16,17,18,22) |
| InChIKey | SIQYQBAPGWSZQF-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 128.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|