C18H21FN2O7P+ — CID 56926566
benzyl [(2R,3R,4S,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 56926566) has the molecular formula C18H21FN2O7P+ and a molecular weight of 427.35 g/mol. Its IUPAC name is benzyl [(2R,3R,4S,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | benzyl [(2R,3R,4S,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 56926566 |
| Molecular Formula | C18H21FN2O7P+ |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | benzyl [(2R,3R,4S,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | NC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)(O)OCc3ccccc3)[C@@H](O)[C@@H]2F)c1 |
| InChI | InChI=1S/C18H20FN2O7P/c19-15-16(22)14(28-18(15)21-8-4-7-13(9-21)17(20)23)11-27-29(24,25)26-10-12-5-2-1-3-6-12/h1-9,14-16,18,22H,10-11H2,(H2-,20,23,24,25)/p+1/t14-,15+,16-,18-/m1/s1 |
| InChIKey | MKUMHCITSSWXDJ-KYHPRHEASA-O |
| XLogP | 1.00 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|