C13H18N2O9P+ — CID 149456850
[(2R,5R)-2-(3-carbamoylpyridin-1-ium-1-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] acetate (PubChem CID 149456850) has the molecular formula C13H18N2O9P+ and a molecular weight of 377.27 g/mol. Its IUPAC name is [(2R,5R)-2-(3-carbamoylpyridin-1-ium-1-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,5R)-2-(3-carbamoylpyridin-1-ium-1-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 149456850 |
| Molecular Formula | C13H18N2O9P+ |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | [(2R,5R)-2-(3-carbamoylpyridin-1-ium-1-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1C(O)[C@@H](COP(=O)(O)O)O[C@H]1[n+]1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C13H17N2O9P/c1-7(16)23-11-10(17)9(6-22-25(19,20)21)24-13(11)15-4-2-3-8(5-15)12(14)18/h2-5,9-11,13,17H,6H2,1H3,(H3-,14,18,19,20,21)/p+1/t9-,10?,11?,13-/m1/s1 |
| InChIKey | YYSMBJQIMJKVCC-ZUYNKMSQSA-O |
| XLogP | -1.63 |
| TPSA | 169.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|