C11H14Cl2N2O7P+ — CID 121300373
[(2R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-4,4-dichloro-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 121300373) has the molecular formula C11H14Cl2N2O7P+ and a molecular weight of 388.12 g/mol. Its IUPAC name is [(2R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-4,4-dichloro-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-4,4-dichloro-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 121300373 |
| Molecular Formula | C11H14Cl2N2O7P+ |
| Molecular Weight | 388.12 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | [(2R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-4,4-dichloro-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | NC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)(O)O)C(O)C2(Cl)Cl)c1 |
| InChI | InChI=1S/C11H13Cl2N2O7P/c12-11(13)8(16)7(5-21-23(18,19)20)22-10(11)15-3-1-2-6(4-15)9(14)17/h1-4,7-8,10,16H,5H2,(H3-,14,17,18,19,20)/p+1/t7-,8?,10-/m1/s1 |
| InChIKey | RNCMTCLLAILPFS-HUWCLSLFSA-O |
| XLogP | -0.39 |
| TPSA | 143.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.12 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|