About 1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide
1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide (PubChem CID 74961197) has the molecular formula C11H13F2N2O4+
and a molecular weight of 275.23 g/mol. Its IUPAC name is 1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide.
Molecular Properties
| Compound Name | 1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide |
| PubChem CID | 74961197 |
| Molecular Formula | C11H13F2N2O4+ |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide |
| SMILES | NC(=O)c1ccc[n+](C2OC(CO)C(O)C2(F)F)c1 |
| InChI | InChI=1S/C11H12F2N2O4/c12-11(13)8(17)7(5-16)19-10(11)15-3-1-2-6(4-15)9(14)18/h1-4,7-8,10,16-17H,5H2,(H-,14,18)/p+1 |
| InChIKey | MKMDAXXYPAUUKH-UHFFFAOYSA-O |
| XLogP | -1.04 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide?
The IUPAC name of 1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide (CID 74961197) is 1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide.
What is the SMILES notation for 1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide?
The canonical SMILES for 1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide is NC(=O)c1ccc[n+](C2OC(CO)C(O)C2(F)F)c1.
What is the InChIKey of 1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide?
The InChIKey is MKMDAXXYPAUUKH-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H12F2N2O4/c12-11(13)8(17)7(5-16)19-10(11)15-3-1-2-6(4-15)9(14)18/h1-4,7-8,10,16-17H,5H2,(H-,14,18)/p+1.
What are the key properties of 1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide?
1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide has a molecular weight of 275.23 g/mol, XLogP of -1.04, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide is sourced from PubChem (CID 74961197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).