C11H14BrClN2O4 — CID 168818578
1-[(2R,3S,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide bromide (PubChem CID 168818578) has the molecular formula C11H14BrClN2O4 and a molecular weight of 353.60 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide bromide.
| Compound Name | 1-[(2R,3S,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide bromide |
|---|---|
| PubChem CID | 168818578 |
| Molecular Formula | C11H14BrClN2O4 |
| Molecular Weight | 353.60 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 1-[(2R,3S,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide bromide |
| SMILES | NC(=O)c1ccc[n+]([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2Cl)c1.[Br-] |
| InChI | InChI=1S/C11H13ClN2O4.BrH/c12-8-9(16)7(5-15)18-11(8)14-3-1-2-6(4-14)10(13)17;/h1-4,7-9,11,15-16H,5H2,(H-,13,17);1H/t7-,8+,9-,11-;/m1./s1 |
| InChIKey | XYUFRKXLUYAYJU-FJUHTSHGSA-N |
| XLogP | -4.07 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.60 |
| LogP ≤ 5 | -4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|